C12H19N3 — CID 142941226
(5Z,7Z)-7-methyl-2-piperazin-1-yl-3,4-dihydroazocine (PubChem CID 142941226) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is (5Z,7Z)-7-methyl-2-piperazin-1-yl-3,4-dihydroazocine.
| Compound Name | (5Z,7Z)-7-methyl-2-piperazin-1-yl-3,4-dihydroazocine |
|---|---|
| PubChem CID | 142941226 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (5Z,7Z)-7-methyl-2-piperazin-1-yl-3,4-dihydroazocine |
| SMILES | CC1=C/N=C(/N2CCNCC2)CC/C=C\1 |
| InChI | InChI=1S/C12H19N3/c1-11-4-2-3-5-12(14-10-11)15-8-6-13-7-9-15/h2,4,10,13H,3,5-9H2,1H3/b4-2-,11-10-,14-12+ |
| InChIKey | OVFBBVJGEYJVHT-YONHCYNCSA-N |
| XLogP | 1.54 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |