C33H43ClN6O — CID 142941658
N-[(2R)-1-(4-chlorophenyl)-3-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 142941658) has the molecular formula C33H43ClN6O and a molecular weight of 575.20 g/mol. Its IUPAC name is N-[(2R)-1-(4-chlorophenyl)-3-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[(2R)-1-(4-chlorophenyl)-3-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 142941658 |
| Molecular Formula | C33H43ClN6O |
| Molecular Weight | 575.20 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | N-[(2R)-1-(4-chlorophenyl)-3-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccc(Cl)cc1)CN1CCC(Cn2cncn2)(C2CCCCC2)CC1)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C33H43ClN6O/c34-29-12-10-25(11-13-29)18-30(38-32(41)31-19-26-6-4-5-7-27(26)20-36-31)21-39-16-14-33(15-17-39,22-40-24-35-23-37-40)28-8-2-1-3-9-28/h4-7,10-13,23-24,28,30-31,36H,1-3,8-9,14-22H2,(H,38,41)/t30-,31?/m1/s1 |
| InChIKey | WTXJMHCYZUADDP-PBBFAOSKSA-N |
| XLogP | 5.04 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |