C37H49N3O7 — CID 142941676
N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide;1,4-xylene (PubChem CID 142941676) has the molecular formula C37H49N3O7 and a molecular weight of 647.81 g/mol. Its IUPAC name is N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide;1,4-xylene.
| Compound Name | N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide;1,4-xylene |
|---|---|
| PubChem CID | 142941676 |
| Molecular Formula | C37H49N3O7 |
| Molecular Weight | 647.81 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide;1,4-xylene |
| SMILES | CC(NC(=O)c1cc(=O)c2cc(O)c(O)cc2o1)C(=O)N1CCC(C(=O)NC(C)(C)C)(C2CCCCC2)CC1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C29H39N3O7.C8H10/c1-17(30-25(36)24-15-20(33)19-14-21(34)22(35)16-23(19)39-24)26(37)32-12-10-29(11-13-32,18-8-6-5-7-9-18)27(38)31-28(2,3)4;1-7-3-5-8(2)6-4-7/h14-18,34-35H,5-13H2,1-4H3,(H,30,36)(H,31,38);3-6H,1-2H3 |
| InChIKey | ZAYZSKIUYHUZRI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.81 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|