C29H39N3O7 — CID 142941677
N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide (PubChem CID 142941677) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide.
| Compound Name | N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142941677 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | N-tert-butyl-4-cyclohexyl-1-[2-[(6,7-dihydroxy-4-oxochromene-2-carbonyl)amino]propanoyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(=O)c2cc(O)c(O)cc2o1)C(=O)N1CCC(C(=O)NC(C)(C)C)(C2CCCCC2)CC1 |
| InChI | InChI=1S/C29H39N3O7/c1-17(30-25(36)24-15-20(33)19-14-21(34)22(35)16-23(19)39-24)26(37)32-12-10-29(11-13-32,18-8-6-5-7-9-18)27(38)31-28(2,3)4/h14-18,34-35H,5-13H2,1-4H3,(H,30,36)(H,31,38) |
| InChIKey | VCXBEOPVHMECND-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|