C18H16BrN3O2 — CID 142947521
2-[4-(aminomethyl)phenyl]-5-bromo-4-phenylmethoxy-1H-pyrimidin-6-one (PubChem CID 142947521) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]-5-bromo-4-phenylmethoxy-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(aminomethyl)phenyl]-5-bromo-4-phenylmethoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 142947521 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]-5-bromo-4-phenylmethoxy-1H-pyrimidin-6-one |
| SMILES | NCc1ccc(-c2nc(OCc3ccccc3)c(Br)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H16BrN3O2/c19-15-17(23)21-16(14-8-6-12(10-20)7-9-14)22-18(15)24-11-13-4-2-1-3-5-13/h1-9H,10-11,20H2,(H,21,22,23) |
| InChIKey | JYQZDLFOVHNXRW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |