C20H17BrN2O5 — CID 136650355
2-[4-(bromomethyl)phenyl]-6-oxo-5-(phenylmethoxymethoxy)-1H-pyrimidine-4-carboxylic acid (PubChem CID 136650355) has the molecular formula C20H17BrN2O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is 2-[4-(bromomethyl)phenyl]-6-oxo-5-(phenylmethoxymethoxy)-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-[4-(bromomethyl)phenyl]-6-oxo-5-(phenylmethoxymethoxy)-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136650355 |
| Molecular Formula | C20H17BrN2O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[4-(bromomethyl)phenyl]-6-oxo-5-(phenylmethoxymethoxy)-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc(CBr)cc2)[nH]c(=O)c1OCOCc1ccccc1 |
| InChI | InChI=1S/C20H17BrN2O5/c21-10-13-6-8-15(9-7-13)18-22-16(20(25)26)17(19(24)23-18)28-12-27-11-14-4-2-1-3-5-14/h1-9H,10-12H2,(H,25,26)(H,22,23,24) |
| InChIKey | KNUAGCHBWWMRAC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|