C23H22N2O4 — CID 137053482
6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid (PubChem CID 137053482) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 137053482 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(C2CCCC2c2ccccc2)[nH]c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H22N2O4/c26-22-20(29-14-15-8-3-1-4-9-15)19(23(27)28)24-21(25-22)18-13-7-12-17(18)16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H,27,28)(H,24,25,26) |
| InChIKey | UACGVZNRMNHKEC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |