C48H48N4O8 — CID 136509186
6-oxo-2-[(1-phenylcyclopentyl)methyl]-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid (PubChem CID 136509186) has the molecular formula C48H48N4O8 and a molecular weight of 808.93 g/mol. Its IUPAC name is 6-oxo-2-[(1-phenylcyclopentyl)methyl]-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 6-oxo-2-[(1-phenylcyclopentyl)methyl]-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136509186 |
| Molecular Formula | C48H48N4O8 |
| Molecular Weight | 808.93 g/mol |
| Exact Mass | 808.35 |
| IUPAC Name | 6-oxo-2-[(1-phenylcyclopentyl)methyl]-5-phenylmethoxy-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(CC2(c3ccccc3)CCCC2)[nH]c(=O)c1OCc1ccccc1.O=C(O)c1nc(CC2(c3ccccc3)CCCC2)[nH]c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/2C24H24N2O4/c2*27-22-21(30-16-17-9-3-1-4-10-17)20(23(28)29)25-19(26-22)15-24(13-7-8-14-24)18-11-5-2-6-12-18/h2*1-6,9-12H,7-8,13-16H2,(H,28,29)(H,25,26,27) |
| InChIKey | CUSZNJLIEHANEX-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 184.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.93 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |