C26H35FN2O4 — CID 136509415
tert-butyl 5-butoxy-2-[[1-[3-(fluoromethyl)phenyl]cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 136509415) has the molecular formula C26H35FN2O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is tert-butyl 5-butoxy-2-[[1-[3-(fluoromethyl)phenyl]cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | tert-butyl 5-butoxy-2-[[1-[3-(fluoromethyl)phenyl]cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 136509415 |
| Molecular Formula | C26H35FN2O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | tert-butyl 5-butoxy-2-[[1-[3-(fluoromethyl)phenyl]cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CCCCOc1c(C(=O)OC(C)(C)C)nc(CC2(c3cccc(CF)c3)CCCC2)[nH]c1=O |
| InChI | InChI=1S/C26H35FN2O4/c1-5-6-14-32-22-21(24(31)33-25(2,3)4)28-20(29-23(22)30)16-26(12-7-8-13-26)19-11-9-10-18(15-19)17-27/h9-11,15H,5-8,12-14,16-17H2,1-4H3,(H,28,29,30) |
| InChIKey | CPZGNAAXYDDPQW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|