C26H28F2N2O4 — CID 136509305
tert-butyl 5-butoxy-2-[[2-(2,3-difluorophenyl)phenyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 136509305) has the molecular formula C26H28F2N2O4 and a molecular weight of 470.52 g/mol. Its IUPAC name is tert-butyl 5-butoxy-2-[[2-(2,3-difluorophenyl)phenyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | tert-butyl 5-butoxy-2-[[2-(2,3-difluorophenyl)phenyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 136509305 |
| Molecular Formula | C26H28F2N2O4 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | tert-butyl 5-butoxy-2-[[2-(2,3-difluorophenyl)phenyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CCCCOc1c(C(=O)OC(C)(C)C)nc(Cc2ccccc2-c2cccc(F)c2F)[nH]c1=O |
| InChI | InChI=1S/C26H28F2N2O4/c1-5-6-14-33-23-22(25(32)34-26(2,3)4)29-20(30-24(23)31)15-16-10-7-8-11-17(16)18-12-9-13-19(27)21(18)28/h7-13H,5-6,14-15H2,1-4H3,(H,29,30,31) |
| InChIKey | KUPSAWCXJSHPJF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|