C25H33BrN2O4 — CID 136509346
tert-butyl 2-[[1-(4-bromophenyl)cyclopentyl]methyl]-5-butoxy-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 136509346) has the molecular formula C25H33BrN2O4 and a molecular weight of 505.45 g/mol. Its IUPAC name is tert-butyl 2-[[1-(4-bromophenyl)cyclopentyl]methyl]-5-butoxy-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | tert-butyl 2-[[1-(4-bromophenyl)cyclopentyl]methyl]-5-butoxy-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 136509346 |
| Molecular Formula | C25H33BrN2O4 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | tert-butyl 2-[[1-(4-bromophenyl)cyclopentyl]methyl]-5-butoxy-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CCCCOc1c(C(=O)OC(C)(C)C)nc(CC2(c3ccc(Br)cc3)CCCC2)[nH]c1=O |
| InChI | InChI=1S/C25H33BrN2O4/c1-5-6-15-31-21-20(23(30)32-24(2,3)4)27-19(28-22(21)29)16-25(13-7-8-14-25)17-9-11-18(26)12-10-17/h9-12H,5-8,13-16H2,1-4H3,(H,27,28,29) |
| InChIKey | LDRUEOPZUGIVMH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|