C27H30N2O4 — CID 137069087
tert-butyl 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylate (PubChem CID 137069087) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylate.
| Compound Name | tert-butyl 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 137069087 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | tert-butyl 6-oxo-2-(2-phenylcyclopentyl)-5-phenylmethoxy-1H-pyrimidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc(C2CCCC2c2ccccc2)[nH]c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O4/c1-27(2,3)33-26(31)22-23(32-17-18-11-6-4-7-12-18)25(30)29-24(28-22)21-16-10-15-20(21)19-13-8-5-9-14-19/h4-9,11-14,20-21H,10,15-17H2,1-3H3,(H,28,29,30) |
| InChIKey | CAFWPVXFYGUEMU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |