C21H24Cl2N2O4 — CID 136509423
5-butoxy-2-[[1-(3,4-dichlorophenyl)cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 136509423) has the molecular formula C21H24Cl2N2O4 and a molecular weight of 439.34 g/mol. Its IUPAC name is 5-butoxy-2-[[1-(3,4-dichlorophenyl)cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-butoxy-2-[[1-(3,4-dichlorophenyl)cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136509423 |
| Molecular Formula | C21H24Cl2N2O4 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 5-butoxy-2-[[1-(3,4-dichlorophenyl)cyclopentyl]methyl]-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | CCCCOc1c(C(=O)O)nc(CC2(c3ccc(Cl)c(Cl)c3)CCCC2)[nH]c1=O |
| InChI | InChI=1S/C21H24Cl2N2O4/c1-2-3-10-29-18-17(20(27)28)24-16(25-19(18)26)12-21(8-4-5-9-21)13-6-7-14(22)15(23)11-13/h6-7,11H,2-5,8-10,12H2,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | CKCJPBZYNYICHA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|