About N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine
N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine (PubChem CID 123183456) has the molecular formula C17H25Cl2N
and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine.
Molecular Properties
| Compound Name | N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine |
| PubChem CID | 123183456 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine |
| SMILES | CCCCCN(C)CC1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C17H25Cl2N/c1-3-4-5-11-20(2)13-17(9-6-10-17)14-7-8-15(18)16(19)12-14/h7-8,12H,3-6,9-11,13H2,1-2H3 |
| InChIKey | BXWGKLIZIXYEHG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine?
The IUPAC name of N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine (CID 123183456) is N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine.
What is the SMILES notation for N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine?
The canonical SMILES for N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine is CCCCCN(C)CC1(c2ccc(Cl)c(Cl)c2)CCC1.
What is the InChIKey of N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine?
The InChIKey is BXWGKLIZIXYEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25Cl2N/c1-3-4-5-11-20(2)13-17(9-6-10-17)14-7-8-15(18)16(19)12-14/h7-8,12H,3-6,9-11,13H2,1-2H3.
What are the key properties of N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine?
N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine has a molecular weight of 314.30 g/mol, XLogP of 5.54, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3,4-dichlorophenyl)cyclobutyl]methyl]-N-methylpentan-1-amine is sourced from PubChem (CID 123183456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).