C14H20Cl3N — CID 69397009
4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-amine;hydrochloride (PubChem CID 69397009) has the molecular formula C14H20Cl3N and a molecular weight of 308.68 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-amine;hydrochloride.
| Compound Name | 4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69397009 |
| Molecular Formula | C14H20Cl3N |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCC1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C14H19Cl2N.ClH/c15-12-5-4-11(10-13(12)16)14(7-3-8-14)6-1-2-9-17;/h4-5,10H,1-3,6-9,17H2;1H |
| InChIKey | CGQBOSONMSTWNG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|