C16H24Cl2N+ — CID 144796627
[1-(3,4-dichlorophenyl)cyclobutyl]methyl-pentylazanium (PubChem CID 144796627) has the molecular formula C16H24Cl2N+ and a molecular weight of 301.28 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)cyclobutyl]methyl-pentylazanium.
| Compound Name | [1-(3,4-dichlorophenyl)cyclobutyl]methyl-pentylazanium |
|---|---|
| PubChem CID | 144796627 |
| Molecular Formula | C16H24Cl2N+ |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [1-(3,4-dichlorophenyl)cyclobutyl]methyl-pentylazanium |
| SMILES | CCCCC[NH2+]CC1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C16H23Cl2N/c1-2-3-4-10-19-12-16(8-5-9-16)13-6-7-14(17)15(18)11-13/h6-7,11,19H,2-5,8-10,12H2,1H3/p+1 |
| InChIKey | YAVXVKVEZFIYER-UHFFFAOYSA-O |
| XLogP | 4.17 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|