C16H24Cl2NO+ — CID 144796606
[2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-diethylazanium (PubChem CID 144796606) has the molecular formula C16H24Cl2NO+ and a molecular weight of 317.28 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-diethylazanium.
| Compound Name | [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-diethylazanium |
|---|---|
| PubChem CID | 144796606 |
| Molecular Formula | C16H24Cl2NO+ |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-diethylazanium |
| SMILES | CC[NH+](CC)CC(O)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C16H23Cl2NO/c1-3-19(4-2)11-15(20)16(8-5-9-16)12-6-7-13(17)14(18)10-12/h6-7,10,15,20H,3-5,8-9,11H2,1-2H3/p+1 |
| InChIKey | OHFFBEXQXIBMOO-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |