C17H25Cl2NO2 — CID 19823817
5-[1-(3,4-dichlorophenyl)cyclobutyl]-5-(dimethylamino)pentane-1,2-diol (PubChem CID 19823817) has the molecular formula C17H25Cl2NO2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 5-[1-(3,4-dichlorophenyl)cyclobutyl]-5-(dimethylamino)pentane-1,2-diol.
| Compound Name | 5-[1-(3,4-dichlorophenyl)cyclobutyl]-5-(dimethylamino)pentane-1,2-diol |
|---|---|
| PubChem CID | 19823817 |
| Molecular Formula | C17H25Cl2NO2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-[1-(3,4-dichlorophenyl)cyclobutyl]-5-(dimethylamino)pentane-1,2-diol |
| SMILES | CN(C)C(CCC(O)CO)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C17H25Cl2NO2/c1-20(2)16(7-5-13(22)11-21)17(8-3-9-17)12-4-6-14(18)15(19)10-12/h4,6,10,13,16,21-22H,3,5,7-9,11H2,1-2H3 |
| InChIKey | ROTIBVLKBBCUIR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |