C17H26ClN — CID 56621938
1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylpentan-1-amine (PubChem CID 56621938) has the molecular formula C17H26ClN and a molecular weight of 279.86 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylpentan-1-amine.
| Compound Name | 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 56621938 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.86 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylpentan-1-amine |
| SMILES | CCCCC(N(C)C)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C17H26ClN/c1-4-5-7-16(19(2)3)17(12-6-13-17)14-8-10-15(18)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3 |
| InChIKey | ZRQNZTCORFVCOG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |