C17H26BrNO — CID 19823609
1-[1-(4-bromophenyl)cyclobutyl]-4-methoxy-N,N-dimethylbutan-1-amine (PubChem CID 19823609) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)cyclobutyl]-4-methoxy-N,N-dimethylbutan-1-amine.
| Compound Name | 1-[1-(4-bromophenyl)cyclobutyl]-4-methoxy-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 19823609 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[1-(4-bromophenyl)cyclobutyl]-4-methoxy-N,N-dimethylbutan-1-amine |
| SMILES | COCCCC(N(C)C)C1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C17H26BrNO/c1-19(2)16(6-4-13-20-3)17(11-5-12-17)14-7-9-15(18)10-8-14/h7-10,16H,4-6,11-13H2,1-3H3 |
| InChIKey | MRFMSLVSPAYXRI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|