C20H31Cl2NO — CID 19823631
8-[1-(3,4-dichlorophenyl)cyclobutyl]-8-(dimethylamino)octan-2-ol (PubChem CID 19823631) has the molecular formula C20H31Cl2NO and a molecular weight of 372.38 g/mol. Its IUPAC name is 8-[1-(3,4-dichlorophenyl)cyclobutyl]-8-(dimethylamino)octan-2-ol.
| Compound Name | 8-[1-(3,4-dichlorophenyl)cyclobutyl]-8-(dimethylamino)octan-2-ol |
|---|---|
| PubChem CID | 19823631 |
| Molecular Formula | C20H31Cl2NO |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 8-[1-(3,4-dichlorophenyl)cyclobutyl]-8-(dimethylamino)octan-2-ol |
| SMILES | CC(O)CCCCCC(N(C)C)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C20H31Cl2NO/c1-15(24)8-5-4-6-9-19(23(2)3)20(12-7-13-20)16-10-11-17(21)18(22)14-16/h10-11,14-15,19,24H,4-9,12-13H2,1-3H3 |
| InChIKey | LYAAPUBXHLKNCF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|