C19H30ClNO — CID 19823690
1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethyl-4-propan-2-yloxybutan-1-amine (PubChem CID 19823690) has the molecular formula C19H30ClNO and a molecular weight of 323.91 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethyl-4-propan-2-yloxybutan-1-amine.
| Compound Name | 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethyl-4-propan-2-yloxybutan-1-amine |
|---|---|
| PubChem CID | 19823690 |
| Molecular Formula | C19H30ClNO |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethyl-4-propan-2-yloxybutan-1-amine |
| SMILES | CC(C)OCCCC(N(C)C)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C19H30ClNO/c1-15(2)22-14-5-7-18(21(3)4)19(12-6-13-19)16-8-10-17(20)11-9-16/h8-11,15,18H,5-7,12-14H2,1-4H3 |
| InChIKey | ZNVNKNZECCAPSH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|