About [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium
[2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium (PubChem CID 140667647) has the molecular formula C16H22Cl2NO+
and a molecular weight of 315.26 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium.
Molecular Properties
| Compound Name | [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium |
| PubChem CID | 140667647 |
| Molecular Formula | C16H22Cl2NO+ |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium |
| SMILES | CC1([NH2+]CC(O)C2(c3ccc(Cl)c(Cl)c3)CCC2)CC1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-15(7-8-15)19-10-14(20)16(5-2-6-16)11-3-4-12(17)13(18)9-11/h3-4,9,14,19-20H,2,5-8,10H2,1H3/p+1 |
| InChIKey | YVKPMOVGNUMSCQ-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium?
The IUPAC name of [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium (CID 140667647) is [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium.
What is the SMILES notation for [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium?
The canonical SMILES for [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium is CC1([NH2+]CC(O)C2(c3ccc(Cl)c(Cl)c3)CCC2)CC1.
What is the InChIKey of [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium?
The InChIKey is YVKPMOVGNUMSCQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H21Cl2NO/c1-15(7-8-15)19-10-14(20)16(5-2-6-16)11-3-4-12(17)13(18)9-11/h3-4,9,14,19-20H,2,5-8,10H2,1H3/p+1.
What are the key properties of [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium?
[2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium has a molecular weight of 315.26 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyethyl]-(1-methylcyclopropyl)azanium is sourced from PubChem (CID 140667647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).