C21H21N3O4 — CID 136509331
5-butoxy-6-oxo-2-[(3-phenyl-2-pyridinyl)methyl]-1H-pyrimidine-4-carboxylic acid (PubChem CID 136509331) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-butoxy-6-oxo-2-[(3-phenyl-2-pyridinyl)methyl]-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-butoxy-6-oxo-2-[(3-phenyl-2-pyridinyl)methyl]-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136509331 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-butoxy-6-oxo-2-[(3-phenyl-2-pyridinyl)methyl]-1H-pyrimidine-4-carboxylic acid |
| SMILES | CCCCOc1c(C(=O)O)nc(Cc2ncccc2-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C21H21N3O4/c1-2-3-12-28-19-18(21(26)27)23-17(24-20(19)25)13-16-15(10-7-11-22-16)14-8-5-4-6-9-14/h4-11H,2-3,12-13H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | BJACEBUBRVKNLO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|