C24H42N6OS — CID 142948236
ethanol;methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate;N-methylethanamine (PubChem CID 142948236) has the molecular formula C24H42N6OS and a molecular weight of 462.71 g/mol. Its IUPAC name is ethanol;methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate;N-methylethanamine.
| Compound Name | ethanol;methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate;N-methylethanamine |
|---|---|
| PubChem CID | 142948236 |
| Molecular Formula | C24H42N6OS |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | ethanol;methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate;N-methylethanamine |
| SMILES | CCNC.CCNCC(C)/N=C(\SC)c1ccnc(Nc2cc(C)cc(C)c2)n1.CCO |
| InChI | InChI=1S/C19H27N5S.C3H9N.C2H6O/c1-6-20-12-15(4)22-18(25-5)17-7-8-21-19(24-17)23-16-10-13(2)9-14(3)11-16;1-3-4-2;1-2-3/h7-11,15,20H,6,12H2,1-5H3,(H,21,23,24);4H,3H2,1-2H3;3H,2H2,1H3/b22-18-;; |
| InChIKey | KMNQOKGSIAQBCS-VCOKVDDTSA-N |
| XLogP | 4.17 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|