C19H27N5S — CID 142948237
methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate (PubChem CID 142948237) has the molecular formula C19H27N5S and a molecular weight of 357.53 g/mol. Its IUPAC name is methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate.
| Compound Name | methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate |
|---|---|
| PubChem CID | 142948237 |
| Molecular Formula | C19H27N5S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | methyl 2-(3,5-dimethylanilino)-N-[1-(ethylamino)propan-2-yl]pyrimidine-4-carboximidothioate |
| SMILES | CCNCC(C)/N=C(\SC)c1ccnc(Nc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C19H27N5S/c1-6-20-12-15(4)22-18(25-5)17-7-8-21-19(24-17)23-16-10-13(2)9-14(3)11-16/h7-11,15,20H,6,12H2,1-5H3,(H,21,23,24)/b22-18- |
| InChIKey | XBDXVCMDVAEORJ-PYCFMQQDSA-N |
| XLogP | 3.94 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|