C23H27F3N2O2S — CID 142949003
[4-(trifluoromethoxy)phenyl]methyl N-ethyl-N-[(Z)-1-(2-methoxyphenyl)but-1-enyl]-N'-methylcarbamimidothioate (PubChem CID 142949003) has the molecular formula C23H27F3N2O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl N-ethyl-N-[(Z)-1-(2-methoxyphenyl)but-1-enyl]-N'-methylcarbamimidothioate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl N-ethyl-N-[(Z)-1-(2-methoxyphenyl)but-1-enyl]-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 142949003 |
| Molecular Formula | C23H27F3N2O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl N-ethyl-N-[(Z)-1-(2-methoxyphenyl)but-1-enyl]-N'-methylcarbamimidothioate |
| SMILES | CC/C=C(/c1ccccc1OC)N(CC)/C(=N/C)SCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F3N2O2S/c1-5-9-20(19-10-7-8-11-21(19)29-4)28(6-2)22(27-3)31-16-17-12-14-18(15-13-17)30-23(24,25)26/h7-15H,5-6,16H2,1-4H3/b20-9-,27-22- |
| InChIKey | JKGNWPHZABGILZ-JCFBFBRESA-N |
| XLogP | 6.59 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|