C20H24O6S — CID 142949660
[(7R)-7-(cyclohexa-2,4-dien-1-ylmethoxy)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] thiophene-2-carboxylate (PubChem CID 142949660) has the molecular formula C20H24O6S and a molecular weight of 392.47 g/mol. Its IUPAC name is [(7R)-7-(cyclohexa-2,4-dien-1-ylmethoxy)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] thiophene-2-carboxylate.
| Compound Name | [(7R)-7-(cyclohexa-2,4-dien-1-ylmethoxy)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 142949660 |
| Molecular Formula | C20H24O6S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(7R)-7-(cyclohexa-2,4-dien-1-ylmethoxy)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] thiophene-2-carboxylate |
| SMILES | O=C(OC1C(CO)OC2CCOC2[C@H]1OCC1C=CC=CC1)c1cccs1 |
| InChI | InChI=1S/C20H24O6S/c21-11-15-18(26-20(22)16-7-4-10-27-16)19(17-14(25-15)8-9-23-17)24-12-13-5-2-1-3-6-13/h1-5,7,10,13-15,17-19,21H,6,8-9,11-12H2/t13?,14?,15?,17?,18?,19-/m1/s1 |
| InChIKey | WFBQHNCCLADPRL-FCBCEHCISA-N |
| XLogP | 2.34 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |