C12H18N2O — CID 142949804
7-methyl-3,4,5,6-tetrahydro-2H-1,7-benzoxazonin-10-amine (PubChem CID 142949804) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 7-methyl-3,4,5,6-tetrahydro-2H-1,7-benzoxazonin-10-amine.
| Compound Name | 7-methyl-3,4,5,6-tetrahydro-2H-1,7-benzoxazonin-10-amine |
|---|---|
| PubChem CID | 142949804 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 7-methyl-3,4,5,6-tetrahydro-2H-1,7-benzoxazonin-10-amine |
| SMILES | CN1CCCCCOc2cc(N)ccc21 |
| InChI | InChI=1S/C12H18N2O/c1-14-7-3-2-4-8-15-12-9-10(13)5-6-11(12)14/h5-6,9H,2-4,7-8,13H2,1H3 |
| InChIKey | VGSRSCRWKYRANX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|