About N-ethyl-3-methoxyaniline
N-ethyl-3-methoxyaniline (PubChem CID 586008) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-ethyl-3-methoxyaniline.
Molecular Properties
| Compound Name | N-ethyl-3-methoxyaniline |
| PubChem CID | 586008 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-ethyl-3-methoxyaniline |
| SMILES | CCNc1cccc(OC)c1 |
| InChI | InChI=1S/C9H13NO/c1-3-10-8-5-4-6-9(7-8)11-2/h4-7,10H,3H2,1-2H3 |
| InChIKey | AFQXCZCRJSGHPB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-3-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methoxyaniline?
The IUPAC name of N-ethyl-3-methoxyaniline (CID 586008) is N-ethyl-3-methoxyaniline.
What is the SMILES notation for N-ethyl-3-methoxyaniline?
The canonical SMILES for N-ethyl-3-methoxyaniline is CCNc1cccc(OC)c1.
What is the InChIKey of N-ethyl-3-methoxyaniline?
The InChIKey is AFQXCZCRJSGHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-10-8-5-4-6-9(7-8)11-2/h4-7,10H,3H2,1-2H3.
What are the key properties of N-ethyl-3-methoxyaniline?
N-ethyl-3-methoxyaniline has a molecular weight of 151.21 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methoxyaniline is sourced from PubChem (CID 586008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).