C12H24N2 — CID 142951324
(E)-N',3-dimethyl-N-pentylpent-2-enimidamide (PubChem CID 142951324) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (E)-N',3-dimethyl-N-pentylpent-2-enimidamide.
| Compound Name | (E)-N',3-dimethyl-N-pentylpent-2-enimidamide |
|---|---|
| PubChem CID | 142951324 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (E)-N',3-dimethyl-N-pentylpent-2-enimidamide |
| SMILES | CCCCCNC(/C=C(\C)CC)=N\C |
| InChI | InChI=1S/C12H24N2/c1-5-7-8-9-14-12(13-4)10-11(3)6-2/h10H,5-9H2,1-4H3,(H,13,14)/b11-10+ |
| InChIKey | VPYWGODCFOHAFP-ZHACJKMWSA-N |
| XLogP | 3.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|