C30H34FNO4 — CID 142952761
(2R,3R,4S)-2-[4-[2-[(3R,4R)-3,4-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-5-fluoro-3-(4-hydroxyphenyl)-4-methyl-3,4-dihydro-2H-chromen-6-ol (PubChem CID 142952761) has the molecular formula C30H34FNO4 and a molecular weight of 491.60 g/mol. Its IUPAC name is (2R,3R,4S)-2-[4-[2-[(3R,4R)-3,4-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-5-fluoro-3-(4-hydroxyphenyl)-4-methyl-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (2R,3R,4S)-2-[4-[2-[(3R,4R)-3,4-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-5-fluoro-3-(4-hydroxyphenyl)-4-methyl-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 142952761 |
| Molecular Formula | C30H34FNO4 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2R,3R,4S)-2-[4-[2-[(3R,4R)-3,4-dimethylpyrrolidin-1-yl]ethoxy]phenyl]-5-fluoro-3-(4-hydroxyphenyl)-4-methyl-3,4-dihydro-2H-chromen-6-ol |
| SMILES | C[C@@H]1c2c(ccc(O)c2F)O[C@@H](c2ccc(OCCN3C[C@H](C)[C@@H](C)C3)cc2)[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C30H34FNO4/c1-18-16-32(17-19(18)2)14-15-35-24-10-6-22(7-11-24)30-27(21-4-8-23(33)9-5-21)20(3)28-26(36-30)13-12-25(34)29(28)31/h4-13,18-20,27,30,33-34H,14-17H2,1-3H3/t18-,19-,20-,27+,30-/m0/s1 |
| InChIKey | ULLGMLFRIPSFKM-WYNHLRBOSA-N |
| XLogP | 6.22 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |