C10H22N2 — CID 142953317
N'-but-3-enyl-N-ethyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 142953317) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N'-but-3-enyl-N-ethyl-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-but-3-enyl-N-ethyl-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142953317 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N'-but-3-enyl-N-ethyl-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=CCCN(C)CCN(C)CC |
| InChI | InChI=1S/C10H22N2/c1-5-7-8-12(4)10-9-11(3)6-2/h5H,1,6-10H2,2-4H3 |
| InChIKey | OENLBMFWJUSOGV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|