C34H32FN5O3 — CID 142953670
N-benzyl-15-fluoro-14-[3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propylamino]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide (PubChem CID 142953670) has the molecular formula C34H32FN5O3 and a molecular weight of 577.66 g/mol. Its IUPAC name is N-benzyl-15-fluoro-14-[3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propylamino]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide.
| Compound Name | N-benzyl-15-fluoro-14-[3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propylamino]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
|---|---|
| PubChem CID | 142953670 |
| Molecular Formula | C34H32FN5O3 |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | N-benzyl-15-fluoro-14-[3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propylamino]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
| SMILES | CN/C=C\N(C)CCCNc1c(F)cc2c(=O)c(C(=O)NCc3ccccc3)cn3c2c1Oc1cc2ccccc2cc1-3 |
| InChI | InChI=1S/C34H32FN5O3/c1-36-14-16-39(2)15-8-13-37-30-27(35)19-25-31-33(30)43-29-18-24-12-7-6-11-23(24)17-28(29)40(31)21-26(32(25)41)34(42)38-20-22-9-4-3-5-10-22/h3-7,9-12,14,16-19,21,36-37H,8,13,15,20H2,1-2H3,(H,38,42)/b16-14- |
| InChIKey | NVAHVSSVYITNDM-PEZBUJJGSA-N |
| XLogP | 5.74 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|