C32H36FN7O4 — CID 58744364
N-[4-(diaminomethylideneamino)butyl]-15-fluoro-14-(3-morpholin-4-ylpropylamino)-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide (PubChem CID 58744364) has the molecular formula C32H36FN7O4 and a molecular weight of 601.68 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)butyl]-15-fluoro-14-(3-morpholin-4-ylpropylamino)-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide.
| Compound Name | N-[4-(diaminomethylideneamino)butyl]-15-fluoro-14-(3-morpholin-4-ylpropylamino)-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
|---|---|
| PubChem CID | 58744364 |
| Molecular Formula | C32H36FN7O4 |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | N-[4-(diaminomethylideneamino)butyl]-15-fluoro-14-(3-morpholin-4-ylpropylamino)-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
| SMILES | NC(N)=NCCCCNC(=O)c1cn2c3c(c(NCCCN4CCOCC4)c(F)cc3c1=O)Oc1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C32H36FN7O4/c33-24-18-22-28-30(27(24)36-10-5-11-39-12-14-43-15-13-39)44-26-17-21-7-2-1-6-20(21)16-25(26)40(28)19-23(29(22)41)31(42)37-8-3-4-9-38-32(34)35/h1-2,6-7,16-19,36H,3-5,8-15H2,(H,37,42)(H4,34,35,38) |
| InChIKey | GOJVLAXFNRGLSR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|