C29H37FN8O3 — CID 58744913
N-[4-(diaminomethylideneamino)butyl]-11-fluoro-10-[3-(4-methylpiperazin-1-yl)propylamino]-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12,15-heptaene-15-carboxamide (PubChem CID 58744913) has the molecular formula C29H37FN8O3 and a molecular weight of 564.67 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)butyl]-11-fluoro-10-[3-(4-methylpiperazin-1-yl)propylamino]-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12,15-heptaene-15-carboxamide.
| Compound Name | N-[4-(diaminomethylideneamino)butyl]-11-fluoro-10-[3-(4-methylpiperazin-1-yl)propylamino]-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12,15-heptaene-15-carboxamide |
|---|---|
| PubChem CID | 58744913 |
| Molecular Formula | C29H37FN8O3 |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | N-[4-(diaminomethylideneamino)butyl]-11-fluoro-10-[3-(4-methylpiperazin-1-yl)propylamino]-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12,15-heptaene-15-carboxamide |
| SMILES | CN1CCN(CCCNc2c(F)cc3c(=O)c(C(=O)NCCCCN=C(N)N)cn4c3c2Oc2ccccc2-4)CC1 |
| InChI | InChI=1S/C29H37FN8O3/c1-36-13-15-37(16-14-36)12-6-11-33-24-21(30)17-19-25-27(24)41-23-8-3-2-7-22(23)38(25)18-20(26(19)39)28(40)34-9-4-5-10-35-29(31)32/h2-3,7-8,17-18,33H,4-6,9-16H2,1H3,(H,34,40)(H4,31,32,35) |
| InChIKey | XYPONQRJTUBJGB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|