C29H22FN3O6 — CID 142953692
18-[2-aminopropyl(ethyl)amino]-19-fluoro-5,12,22-trioxo-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxylic acid (PubChem CID 142953692) has the molecular formula C29H22FN3O6 and a molecular weight of 527.51 g/mol. Its IUPAC name is 18-[2-aminopropyl(ethyl)amino]-19-fluoro-5,12,22-trioxo-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxylic acid.
| Compound Name | 18-[2-aminopropyl(ethyl)amino]-19-fluoro-5,12,22-trioxo-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxylic acid |
|---|---|
| PubChem CID | 142953692 |
| Molecular Formula | C29H22FN3O6 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 18-[2-aminopropyl(ethyl)amino]-19-fluoro-5,12,22-trioxo-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxylic acid |
| SMILES | CCN(CC(C)N)c1c(F)cc2c(=O)c(C(=O)O)cn3c4cc5c(=O)c6ccccc6c(=O)c5cc4oc1c23 |
| InChI | InChI=1S/C29H22FN3O6/c1-3-32(11-13(2)31)24-20(30)8-18-23-28(24)39-22-10-17-16(25(34)14-6-4-5-7-15(14)26(17)35)9-21(22)33(23)12-19(27(18)36)29(37)38/h4-10,12-13H,3,11,31H2,1-2H3,(H,37,38) |
| InChIKey | WODANZAHYNASJI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|