C32H25F2N3O5 — CID 58727406
18,19-difluoro-5,12,22-trioxo-N-(3-piperidin-1-ylpropyl)-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxamide (PubChem CID 58727406) has the molecular formula C32H25F2N3O5 and a molecular weight of 569.56 g/mol. Its IUPAC name is 18,19-difluoro-5,12,22-trioxo-N-(3-piperidin-1-ylpropyl)-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxamide.
| Compound Name | 18,19-difluoro-5,12,22-trioxo-N-(3-piperidin-1-ylpropyl)-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxamide |
|---|---|
| PubChem CID | 58727406 |
| Molecular Formula | C32H25F2N3O5 |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 18,19-difluoro-5,12,22-trioxo-N-(3-piperidin-1-ylpropyl)-16-oxa-1-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6,8,10,13,17(25),18,20,23-decaene-23-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cn2c3cc4c(=O)c5ccccc5c(=O)c4cc3oc3c(F)c(F)cc(c1=O)c32 |
| InChI | InChI=1S/C32H25F2N3O5/c33-23-13-21-27-31(26(23)34)42-25-15-20-19(28(38)17-7-2-3-8-18(17)29(20)39)14-24(25)37(27)16-22(30(21)40)32(41)35-9-6-12-36-10-4-1-5-11-36/h2-3,7-8,13-16H,1,4-6,9-12H2,(H,35,41) |
| InChIKey | SCSUMVUARMVQIN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|