C25H47N5O — CID 142954106
(2S)-2-amino-1-[4-[but-3-enyl-[2-[[(2Z)-4-methylpenta-2,4-dienylidene]amino]ethyl]amino]piperidin-1-yl]propan-1-one;ethane;(Z)-prop-1-en-1-amine (PubChem CID 142954106) has the molecular formula C25H47N5O and a molecular weight of 433.69 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[but-3-enyl-[2-[[(2Z)-4-methylpenta-2,4-dienylidene]amino]ethyl]amino]piperidin-1-yl]propan-1-one;ethane;(Z)-prop-1-en-1-amine.
| Compound Name | (2S)-2-amino-1-[4-[but-3-enyl-[2-[[(2Z)-4-methylpenta-2,4-dienylidene]amino]ethyl]amino]piperidin-1-yl]propan-1-one;ethane;(Z)-prop-1-en-1-amine |
|---|---|
| PubChem CID | 142954106 |
| Molecular Formula | C25H47N5O |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.38 |
| IUPAC Name | (2S)-2-amino-1-[4-[but-3-enyl-[2-[[(2Z)-4-methylpenta-2,4-dienylidene]amino]ethyl]amino]piperidin-1-yl]propan-1-one;ethane;(Z)-prop-1-en-1-amine |
| SMILES | C/C=C\N.C=CCCN(CC/N=C/C=C\C(=C)C)C1CCN(C(=O)[C@H](C)N)CC1.CC |
| InChI | InChI=1S/C20H34N4O.C3H7N.C2H6/c1-5-6-13-23(16-12-22-11-7-8-17(2)3)19-9-14-24(15-10-19)20(25)18(4)21;1-2-3-4;1-2/h5,7-8,11,18-19H,1-2,6,9-10,12-16,21H2,3-4H3;2-3H,4H2,1H3;1-2H3/b8-7-,22-11+;3-2-;/t18-;;/m0../s1 |
| InChIKey | UWXQTSPOEHYCLF-CYNHYHDISA-N |
| XLogP | 3.91 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|