C23H36N4O — CID 177353064
N-[(1Z,3E,5Z,7E)-8-methyl-3-(methylamino)-6-methylidene-5-(2-methyliminoethylidene)-9-(2-methylpiperidin-1-yl)nona-1,3,7-trienyl]acetamide (PubChem CID 177353064) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is N-[(1Z,3E,5Z,7E)-8-methyl-3-(methylamino)-6-methylidene-5-(2-methyliminoethylidene)-9-(2-methylpiperidin-1-yl)nona-1,3,7-trienyl]acetamide.
| Compound Name | N-[(1Z,3E,5Z,7E)-8-methyl-3-(methylamino)-6-methylidene-5-(2-methyliminoethylidene)-9-(2-methylpiperidin-1-yl)nona-1,3,7-trienyl]acetamide |
|---|---|
| PubChem CID | 177353064 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | N-[(1Z,3E,5Z,7E)-8-methyl-3-(methylamino)-6-methylidene-5-(2-methyliminoethylidene)-9-(2-methylpiperidin-1-yl)nona-1,3,7-trienyl]acetamide |
| SMILES | C=C(/C=C(\C)CN1CCCCC1C)C(/C=C(/C=C\NC(C)=O)NC)=C\C=N\C |
| InChI | InChI=1S/C23H36N4O/c1-18(17-27-14-8-7-9-20(27)3)15-19(2)22(10-12-24-5)16-23(25-6)11-13-26-21(4)28/h10-13,15-16,20,25H,2,7-9,14,17H2,1,3-6H3,(H,26,28)/b13-11-,18-15+,22-10-,23-16+,24-12+ |
| InChIKey | NMDYTJRIXUSXGA-YVXQDNRGSA-N |
| XLogP | 3.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|