C32H51N5O — CID 143056548
(5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine;N-ethylacetamide (PubChem CID 143056548) has the molecular formula C32H51N5O and a molecular weight of 521.79 g/mol. Its IUPAC name is (5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine;N-ethylacetamide.
| Compound Name | (5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine;N-ethylacetamide |
|---|---|
| PubChem CID | 143056548 |
| Molecular Formula | C32H51N5O |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.41 |
| IUPAC Name | (5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine;N-ethylacetamide |
| SMILES | C=C/C(=C\C=C(/CCCC)NC)C(C=CC)=N/C(=C\C)NC(CCC)C1=CCC=CN=C1.CCNC(C)=O |
| InChI | InChI=1S/C28H42N4.C4H9NO/c1-7-12-18-25(29-6)20-19-23(10-4)26(15-8-2)31-28(11-5)32-27(16-9-3)24-17-13-14-21-30-22-24;1-3-5-4(2)6/h8,10-11,14-15,17,19-22,27,29,32H,4,7,9,12-13,16,18H2,1-3,5-6H3;3H2,1-2H3,(H,5,6)/b15-8+,23-19+,25-20+,28-11+,31-26+; |
| InChIKey | KYEAUCRKAXSIMI-PJOOISMUSA-N |
| XLogP | 7.09 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|