C28H42N4 — CID 143056549
(5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine (PubChem CID 143056549) has the molecular formula C28H42N4 and a molecular weight of 434.67 g/mol. Its IUPAC name is (5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine.
| Compound Name | (5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine |
|---|---|
| PubChem CID | 143056549 |
| Molecular Formula | C28H42N4 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (5E,7E,9E,10E)-9-[(Z)-1-[1-(4H-azepin-6-yl)butylamino]prop-1-enyl]imino-8-ethenyl-N-methyldodeca-5,7,10-trien-5-amine |
| SMILES | C=C/C(=C\C=C(/CCCC)NC)C(/C=C/C)=N/C(=C\C)NC(CCC)C1=CCC=CN=C1 |
| InChI | InChI=1S/C28H42N4/c1-7-12-18-25(29-6)20-19-23(10-4)26(15-8-2)31-28(11-5)32-27(16-9-3)24-17-13-14-21-30-22-24/h8,10-11,14-15,17,19-22,27,29,32H,4,7,9,12-13,16,18H2,1-3,5-6H3/b15-8+,23-19+,25-20+,28-11+,31-26+ |
| InChIKey | OLBNFDHHOOABCL-MNTZTXIFSA-N |
| XLogP | 6.94 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|