C17H27N3 — CID 145242433
N-[1-[(E)-[(5Z)-3-methanimidoyl-2-methylhepta-2,5-dien-4-ylidene]amino]ethenyl]cyclohexanamine (PubChem CID 145242433) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[1-[(E)-[(5Z)-3-methanimidoyl-2-methylhepta-2,5-dien-4-ylidene]amino]ethenyl]cyclohexanamine.
| Compound Name | N-[1-[(E)-[(5Z)-3-methanimidoyl-2-methylhepta-2,5-dien-4-ylidene]amino]ethenyl]cyclohexanamine |
|---|---|
| PubChem CID | 145242433 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-[1-[(E)-[(5Z)-3-methanimidoyl-2-methylhepta-2,5-dien-4-ylidene]amino]ethenyl]cyclohexanamine |
| SMILES | [H]/N=C/C(=C(C)C)C(/C=C\C)=N/C(=C)NC1CCCCC1 |
| InChI | InChI=1S/C17H27N3/c1-5-9-17(16(12-18)13(2)3)20-14(4)19-15-10-7-6-8-11-15/h5,9,12,15,18-19H,4,6-8,10-11H2,1-3H3/b9-5-,18-12+,20-17+ |
| InChIKey | SXEKGWVNERNKQG-GRXOUEOGSA-N |
| XLogP | 4.38 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|