C23H35N5 — CID 142202383
(1Z,3E,5E,7R,9E,11Z)-10-(cyclohexyliminomethyl)-13-imino-7-N-methyl-4-(methyliminomethyl)trideca-1,3,5,9,11-pentaene-1,7-diamine (PubChem CID 142202383) has the molecular formula C23H35N5 and a molecular weight of 381.57 g/mol. Its IUPAC name is (1Z,3E,5E,7R,9E,11Z)-10-(cyclohexyliminomethyl)-13-imino-7-N-methyl-4-(methyliminomethyl)trideca-1,3,5,9,11-pentaene-1,7-diamine.
| Compound Name | (1Z,3E,5E,7R,9E,11Z)-10-(cyclohexyliminomethyl)-13-imino-7-N-methyl-4-(methyliminomethyl)trideca-1,3,5,9,11-pentaene-1,7-diamine |
|---|---|
| PubChem CID | 142202383 |
| Molecular Formula | C23H35N5 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (1Z,3E,5E,7R,9E,11Z)-10-(cyclohexyliminomethyl)-13-imino-7-N-methyl-4-(methyliminomethyl)trideca-1,3,5,9,11-pentaene-1,7-diamine |
| SMILES | [H]/N=C\C=C/C(/C=N/C1CCCCC1)=C\C[C@H](/C=C/C(/C=N/C)=C\C=C/N)NC |
| InChI | InChI=1S/C23H35N5/c1-26-18-20(8-6-16-24)12-14-22(27-2)15-13-21(9-7-17-25)19-28-23-10-4-3-5-11-23/h6-9,12-14,16-19,22-23,25,27H,3-5,10-11,15,24H2,1-2H3/b9-7-,14-12+,16-6-,20-8+,21-13+,25-17-,26-18+,28-19+/t22-/m0/s1 |
| InChIKey | YHAJNRXNRXXLDD-NTVOIWFESA-N |
| XLogP | 4.16 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|