C24H38FN4+ — CID 123601192
1-(2,5-dihydro-1H-azepin-3-yl)ethenyl-[9-[1-[fluoro(methyl)amino]ethenylamino]-3,4-dimethyl-7-methylidenenon-3-en-2-ylidene]-methylazanium (PubChem CID 123601192) has the molecular formula C24H38FN4+ and a molecular weight of 401.59 g/mol. Its IUPAC name is 1-(2,5-dihydro-1H-azepin-3-yl)ethenyl-[9-[1-[fluoro(methyl)amino]ethenylamino]-3,4-dimethyl-7-methylidenenon-3-en-2-ylidene]-methylazanium.
| Compound Name | 1-(2,5-dihydro-1H-azepin-3-yl)ethenyl-[9-[1-[fluoro(methyl)amino]ethenylamino]-3,4-dimethyl-7-methylidenenon-3-en-2-ylidene]-methylazanium |
|---|---|
| PubChem CID | 123601192 |
| Molecular Formula | C24H38FN4+ |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | 1-(2,5-dihydro-1H-azepin-3-yl)ethenyl-[9-[1-[fluoro(methyl)amino]ethenylamino]-3,4-dimethyl-7-methylidenenon-3-en-2-ylidene]-methylazanium |
| SMILES | C=C(CCNC(=C)N(C)F)CCC(C)=C(C)/C(C)=[N+](\C)C(=C)C1=CCC=CNC1 |
| InChI | InChI=1S/C24H38FN4/c1-18(14-16-27-23(6)29(8)25)12-13-19(2)20(3)21(4)28(7)22(5)24-11-9-10-15-26-17-24/h10-11,15,26-27H,1,5-6,9,12-14,16-17H2,2-4,7-8H3/q+1/b20-19?,28-21+ |
| InChIKey | CTPUMPLWVAKLAN-WSRHQWAOSA-N |
| XLogP | 4.98 |
| TPSA | 30.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|