C31H53N3O — CID 145014634
(3Z)-2,3-dimethylhexa-1,3-diene;ethane;N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide (PubChem CID 145014634) has the molecular formula C31H53N3O and a molecular weight of 483.79 g/mol. Its IUPAC name is (3Z)-2,3-dimethylhexa-1,3-diene;ethane;N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide.
| Compound Name | (3Z)-2,3-dimethylhexa-1,3-diene;ethane;N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 145014634 |
| Molecular Formula | C31H53N3O |
| Molecular Weight | 483.79 g/mol |
| Exact Mass | 483.42 |
| IUPAC Name | (3Z)-2,3-dimethylhexa-1,3-diene;ethane;N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide |
| SMILES | C=C(C(/C=C\C)=C(/C)NC(C)=O)N1CCCC[C@H]1/C(C=C(C)C)=N/C.C=C(C)/C(C)=C\CC.CC |
| InChI | InChI=1S/C21H33N3O.C8H14.C2H6/c1-8-11-19(16(4)23-18(6)25)17(5)24-13-10-9-12-21(24)20(22-7)14-15(2)3;1-5-6-8(4)7(2)3;1-2/h8,11,14,21H,5,9-10,12-13H2,1-4,6-7H3,(H,23,25);6H,2,5H2,1,3-4H3;1-2H3/b11-8-,19-16-,22-20+;8-6-;/t21-;;/m0../s1 |
| InChIKey | QNNVDPMPASZIDF-CVBVEOENSA-N |
| XLogP | 8.32 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.79 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|