C21H33N3O — CID 145014635
N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide (PubChem CID 145014635) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide.
| Compound Name | N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 145014635 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | N-[(2Z,4Z)-3-[1-[(2S)-2-[N-methyl-C-(2-methylprop-1-enyl)carbonimidoyl]piperidin-1-yl]ethenyl]hexa-2,4-dien-2-yl]acetamide |
| SMILES | C=C(C(/C=C\C)=C(/C)NC(C)=O)N1CCCC[C@H]1/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C21H33N3O/c1-8-11-19(16(4)23-18(6)25)17(5)24-13-10-9-12-21(24)20(22-7)14-15(2)3/h8,11,14,21H,5,9-10,12-13H2,1-4,6-7H3,(H,23,25)/b11-8-,19-16-,22-20+/t21-/m0/s1 |
| InChIKey | NJLMXIRXKWCYFD-YIDGNMNWSA-N |
| XLogP | 4.38 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|