C25H44N6O — CID 145287756
(E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide;methanamine (PubChem CID 145287756) has the molecular formula C25H44N6O and a molecular weight of 444.67 g/mol. Its IUPAC name is (E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide;methanamine.
| Compound Name | (E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide;methanamine |
|---|---|
| PubChem CID | 145287756 |
| Molecular Formula | C25H44N6O |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide;methanamine |
| SMILES | C=C/C=C(C=C)/N=C/C(C(=O)NC1CCN(C)CC1)=C(/CCCCCCCN)N=C.CN |
| InChI | InChI=1S/C24H39N5O.CH5N/c1-5-12-20(6-2)27-19-22(23(26-3)13-10-8-7-9-11-16-25)24(30)28-21-14-17-29(4)18-15-21;1-2/h5-6,12,19,21H,1-3,7-11,13-18,25H2,4H3,(H,28,30);2H2,1H3/b20-12+,23-22+,27-19+; |
| InChIKey | JQRPFLKIUUDZKF-XBJHUMLVSA-N |
| XLogP | 3.35 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|