C24H39N5O — CID 145287757
(E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide (PubChem CID 145287757) has the molecular formula C24H39N5O and a molecular weight of 413.61 g/mol. Its IUPAC name is (E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide.
| Compound Name | (E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide |
|---|---|
| PubChem CID | 145287757 |
| Molecular Formula | C24H39N5O |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | (E)-10-amino-2-[[(3E)-hexa-1,3,5-trien-3-yl]iminomethyl]-3-(methylideneamino)-N-(1-methylpiperidin-4-yl)dec-2-enamide |
| SMILES | C=C/C=C(C=C)/N=C/C(C(=O)NC1CCN(C)CC1)=C(/CCCCCCCN)N=C |
| InChI | InChI=1S/C24H39N5O/c1-5-12-20(6-2)27-19-22(23(26-3)13-10-8-7-9-11-16-25)24(30)28-21-14-17-29(4)18-15-21/h5-6,12,19,21H,1-3,7-11,13-18,25H2,4H3,(H,28,30)/b20-12+,23-22+,27-19+ |
| InChIKey | PQQCRWLOFOKIMH-HDAFBWHKSA-N |
| XLogP | 3.78 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|