C20H29N3O — CID 137427718
(2E,5Z)-1-[(3E,4Z)-3-(2-aminoprop-2-enylidene)-4-propylidenepiperidin-1-yl]-4-methyl-7-methyliminohepta-2,5-dien-1-one (PubChem CID 137427718) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is (2E,5Z)-1-[(3E,4Z)-3-(2-aminoprop-2-enylidene)-4-propylidenepiperidin-1-yl]-4-methyl-7-methyliminohepta-2,5-dien-1-one.
| Compound Name | (2E,5Z)-1-[(3E,4Z)-3-(2-aminoprop-2-enylidene)-4-propylidenepiperidin-1-yl]-4-methyl-7-methyliminohepta-2,5-dien-1-one |
|---|---|
| PubChem CID | 137427718 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (2E,5Z)-1-[(3E,4Z)-3-(2-aminoprop-2-enylidene)-4-propylidenepiperidin-1-yl]-4-methyl-7-methyliminohepta-2,5-dien-1-one |
| SMILES | C=C(N)/C=C1/CN(C(=O)/C=C/C(C)/C=C\C=N\C)CC/C1=C/CC |
| InChI | InChI=1S/C20H29N3O/c1-5-7-18-11-13-23(15-19(18)14-17(3)21)20(24)10-9-16(2)8-6-12-22-4/h6-10,12,14,16H,3,5,11,13,15,21H2,1-2,4H3/b8-6-,10-9+,18-7-,19-14-,22-12+ |
| InChIKey | LIOWCEWYRQFSEY-IQVIHYETSA-N |
| XLogP | 3.40 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|